Compound Q&A

What precautions should be taken when handling 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one (CAS: 920509-28-0)?

Answer

6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one
When handling 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood due to its potential to release toxic vapors. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures. The compound is stable under controlled conditions but should be stored in a dry, cool place, away from moisture and oxidizing agents.

About

English Name 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one
Molecular Formula C13H13Cl2N3O2
Molecular Weight 314.17 g/mol
SMILES CC(C)C1=CC(=NNC1=O)OC2=C(C=C(C=C2Cl)N)Cl
InChIKey PFQNEKHHAFIRRV-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one (CAS: 920509-28-0)?

6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one is a crystalline compound with a mole...

Compound Q&A

How is 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one (CAS: 920509-28-0) typically synthesized?

6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one is typically synthesized via a multi-...

Compound Q&A

What industries use 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one (CAS: 920509-28-0)?

6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one is primarily used in the pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...