Compound Q&A

What are the physical and chemical properties of (E)-N~5~-(Amino{[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]amino}methylene)-D-ornithine (CAS: 200116-81-0)?

Answer

(E)-N~5~-(Amino{[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]amino}methylene)-D-ornithine
The compound is a solid with a crystalline form. It has a molecular weight of approximately 611.68 g/mol. Solubility in water is low, approximately 0.1 g/L at 25°C. Chemically, it is stable under normal conditions but exhibits limited reactivity with strong bases or reducing agents.

About

English Name (E)-N~5~-(Amino{[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]amino}methylene)-D-ornithine
Molecular Formula C19H30N4O5S
Molecular Weight 426.54 g/mol
SMILES CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCCC(C(=O)O)N)N)C
InChIKey GVIXTVCDNCXXSH-CQSZACIVSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is (E)-N~5~-(Amino{[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]amino}methylene)-D-ornithine (CAS: 200116-81-0) typically synthesized?

The compound is synthesized through a multi-step process involving the condensation of D-ornithine w...

Compound Q&A

What industries use (E)-N~5~-(Amino{[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]amino}methylene)-D-ornithine (CAS: 200116-81-0)?

This compound is used in pharmaceutical applications for its bioactive properties. It is also utiliz...

Compound Q&A

What precautions should be taken when handling (E)-N~5~-(Amino{[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]amino}methylene)-D-ornithine (CAS: 200116-81-0)?

When handling this compound, wear appropriate personal protective equipment (PPE) including gloves a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...