Compound Q&A

How is (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid (CAS: 718599-77-1) typically synthesized?

Answer

(3S)-3-Amino-3-(4-cyanophenyl)propanoic acid
(3S)-3-Amino-3-(4-cyanophenyl)propanoic acid is often synthesized through the reaction of 4-cyanobenzoyl chloride with (3S)-3-aminopropanoic acid. The reaction proceeds with the formation of an ester intermediate, which is then hydrolyzed to yield the final product. This process typically involves the use of a phase transfer catalyst and optimization of reaction conditions for high yield and selectivity.

About

English Name (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid
Molecular Formula C10H10N2O2
Molecular Weight 190.2 g/mol
SMILES C1=CC(=CC=C1C#N)C(CC(=O)O)N
InChIKey JFPLLJRLBHIJPS-VIFPVBQESA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid (CAS: 718599-77-1)?

(3S)-3-Amino-3-(4-cyanophenyl)propanoic acid is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid (CAS: 718599-77-1)?

(3S)-3-Amino-3-(4-cyanophenyl)propanoic acid is used in the pharmaceutical industry for the developm...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid (CAS: 718599-77-1)?

When handling (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid, it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...