Compound Q&A

How is (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid (CAS: 718599-77-1) typically synthesized?

Answer

(3S)-3-Amino-3-(4-cyanophenyl)propanoic acid
(3S)-3-Amino-3-(4-cyanophenyl)propanoic acid is often synthesized through the reaction of 4-cyanobenzoyl chloride with (3S)-3-aminopropanoic acid. The reaction proceeds with the formation of an ester intermediate, which is then hydrolyzed to yield the final product. This process typically involves the use of a phase transfer catalyst and optimization of reaction conditions for high yield and selectivity.

About

English Name (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid
Molecular Formula C10H10N2O2
Molecular Weight 190.1986 g/mol
SMILES C1=CC(=CC=C1C#N)C(CC(=O)O)N
InChIKey JFPLLJRLBHIJPS-VIFPVBQESA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid (CAS: 718599-77-1)?

(3S)-3-Amino-3-(4-cyanophenyl)propanoic acid is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid (CAS: 718599-77-1)?

(3S)-3-Amino-3-(4-cyanophenyl)propanoic acid is used in the pharmaceutical industry for the developm...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid (CAS: 718599-77-1)?

When handling (3S)-3-Amino-3-(4-cyanophenyl)propanoic acid, it is important to wear appropriate pers...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...