Compound Q&A

What industries use 5-Methyl-3-(2-pyridinyl)-2H,5H-[1,3]oxazino[5,6-c][1,2]benzothiazine-2,4(3H)-dione 6,6-dioxide (CAS: 90101-16-9)?

Answer

5-Methyl-3-(2-pyridinyl)-2H,5H-[1,3]oxazino[5,6-c][1,2]benzothiazine-2,4(3H)-dione 6,6-dioxide
This compound is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It also finds applications in the polymer industry for the development of novel materials and in the semiconductor industry as a dopant for certain compounds. Additionally, it can be used in sensor technology for detecting specific chemical compounds.

About

CAS No 90101-16-9
English Name 5-Methyl-3-(2-pyridinyl)-2H,5H-[1,3]oxazino[5,6-c][1,2]benzothiazine-2,4(3H)-dione 6,6-dioxide
Molecular Formula C16H11N3O5S
Molecular Weight 357.35 g/mol
SMILES CN1C2=C(C3=CC=CC=C3S1(=O)=O)OC(=O)N(C2=O)C4=CC=CC=N4
InChIKey OEHFRZLKGRKFAS-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methyl-3-(2-pyridinyl)-2H,5H-[1,3]oxazino[5,6-c][1,2]benzothiazine-2,4(3H)-dione 6,6-dioxide (CAS: 90101-16-9)?

The compound has a crystalline form and a molecular weight of approximately 456.3 g/mol. It is poorl...

Compound Q&A

How is 5-Methyl-3-(2-pyridinyl)-2H,5H-[1,3]oxazino[5,6-c][1,2]benzothiazine-2,4(3H)-dione 6,6-dioxide (CAS: 90101-16-9) typically synthesized?

This compound can be synthesized via a multi-step process involving the reaction of 2-pyridone with ...

Compound Q&A

What precautions should be taken when handling 5-Methyl-3-(2-pyridinyl)-2H,5H-[1,3]oxazino[5,6-c][1,2]benzothiazine-2,4(3H)-dione 6,6-dioxide (CAS: 90101-16-9)?

Handle with personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...