Compound Q&A

What are the main uses of 1,1'-Sulfanediylbis(4-nitrobenzene) (CAS: 1223-31-0)?

Answer

1,1'-Sulfanediylbis(4-nitrobenzene)
1,1'-Sulfanediylbis(4-nitrobenzene) is primarily used in research for its reactivity and stability. It is also utilized in the pharmaceutical industry as a precursor for the synthesis of various organic compounds. Additionally, it is employed in industrial processes for its chemical reactivity and stability.

About

CAS No 1223-31-0
English Name 1,1'-Sulfanediylbis(4-nitrobenzene)
Molecular Formula C12H8N2O4S
Molecular Weight 276.27 g/mol
SMILES C1=CC(=CC=C1[N+](=O)[O-])SC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey ZZTJMQPRKBNGNX-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What is 1,1'-Sulfanediylbis(4-nitrobenzene) (CAS: 1223-31-0)?

1,1'-Sulfanediylbis(4-nitrobenzene) is a chemical compound with the CAS number 1223-31-0. It is a ye...

Compound Q&A

Is 1,1'-Sulfanediylbis(4-nitrobenzene) (CAS: 1223-31-0) safe?

1,1'-Sulfanediylbis(4-nitrobenzene) is generally safe under normal handling conditions, but proper s...

Compound Q&A

How should 1,1'-Sulfanediylbis(4-nitrobenzene) (CAS: 1223-31-0) be stored?

1,1'-Sulfanediylbis(4-nitrobenzene) should be stored in a tightly sealed container in a cool, dry, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...