Compound Q&A

How should 4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 1000340-37-3) be stored?

Answer

4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid should be stored in a cool, dry place away from direct sunlight and heat sources. Store it in a tightly sealed container to prevent moisture absorption. Maintain a stable temperature between 15-25°C and avoid exposing the compound to extreme temperatures, which could affect its stability. Humidity levels should be kept low to prevent degradation and ensure the compound remains in a solid form.

About

English Name 4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
Molecular Formula C8H5ClN2O2
Molecular Weight 196.59 g/mol
SMILES C1=CN=C2C(=C1Cl)C(=CN2)C(=O)O
InChIKey CFASASVVIOZGNK-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What is 4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 1000340-37-3)?

4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid, also known as 4-Cl-1H-pyrrolo[2,3-b]pyridine-3...

Compound Q&A

What are the main uses of 4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 1000340-37-3)?

4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is primarily used as a building block in the sy...

Compound Q&A

Is 4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS: 1000340-37-3) safe?

4-Chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is generally safe when handled with appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...