Compound Q&A

What is 4-Bromo-1H-indole-3-carboxylic acid (CAS: 110811-31-9)?

Answer

4-Bromo-1H-indole-3-carboxylic acid
4-Bromo-1H-indole-3-carboxylic acid is a chemical compound with the CAS number 110811-31-9. It is a white solid with a molecular formula of C11H9BrNO2. This compound is known for its aromatic nature and can be used in various applications due to its structural properties.

About

English Name 4-Bromo-1H-indole-3-carboxylic acid
Molecular Formula C9H6BrNO2
Molecular Weight 240.06 g/mol
SMILES C1=CC2=C(C(=C1)Br)C(=CN2)C(=O)O
InChIKey GJQQLCJFHKJARJ-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of 4-Bromo-1H-indole-3-carboxylic acid (CAS: 11081-31-9)?

4-Bromo-1H-indole-3-carboxylic acid is primarily used in pharmaceutical research for the synthesis o...

Compound Q&A

Is 4-Bromo-1H-indole-3-carboxylic acid (CAS: 110811-31-9) safe?

4-Bromo-1H-indole-3-carboxylic acid is considered safe under proper handling conditions. However, it...

Compound Q&A

How should 4-Bromo-1H-indole-3-carboxylic acid (CAS: 110811-31-9) be stored?

4-Bromo-1H-indole-3-carboxylic acid should be stored in a cool, dry, and well-ventilated area away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...