Compound Q&A

What is Clorabacavir racemic (CAS: 172015-79-1)?

Answer

Clorabacavir racemic
Clorabacavir racemic (CAS: 172015-79-1) is a chiral compound with potential antiviral properties. It is a racemic mixture of two enantiomers, which means it contains equal amounts of the left- and right-handed forms. Its exact chemical formula and properties are not widely documented, but it is being researched for its antiviral efficacy.

About

English Name Clorabacavir racemic
Molecular Formula C11H13Cl2N5O
Molecular Weight 302.16 g/mol
SMILES OC[C@@H]1C=C[C@@H](C1)n1cnc2c1nc(N)nc2Cl.Cl
InChIKey VZJFPECAPXUELG-HHQFNNIRSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of Clorabacavir racemic (CAS: 172015-79-1)?

Clorabacavir racemic (CAS: 172015-79-1) is primarily being investigated for its potential use as an ...

Compound Q&A

Is Clorabacavir racemic (CAS: 172015-79-1) safe?

The safety of Clorabacavir racemic (CAS: 172015-79-1) is still under investigation. Preliminary stud...

Compound Q&A

How should Clorabacavir racemic (CAS: 172015-79-1) be stored?

Clorabacavir racemic (CAS: 172015-79-1) should be stored in a cool, dry place away from direct sunli...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...