Compound Q&A

What is 3-Cyclohexyl-1H-indole-6-carboxylic acid (CAS: 494799-17-6)?

Answer

3-Cyclohexyl-1H-indole-6-carboxylic acid
3-Cyclohexyl-1H-indole-6-carboxylic acid (CAS: 494799-17-6) is a derivative of indole, featuring a cyclohexyl substituent on the indole ring. It is a solid, white to off-white powder with a molecular weight of approximately 227.25 g/mol. This compound exhibits pharmacological properties and is used in medicinal chemistry for drug discovery.

About

English Name 3-Cyclohexyl-1H-indole-6-carboxylic acid
Molecular Formula C15H17NO2
Molecular Weight 243.31 g/mol
SMILES C1CCC(CC1)C2=CNC3=C2C=CC(=C3)C(=O)O
InChIKey OZJSQVKDKOOQIT-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of 3-Cyclohexyl-1H-indole-6-carboxylic acid (CAS: 494799-17-6)?

3-Cyclohexyl-1H-indole-6-carboxylic acid (CAS: 494799-17-6) is primarily used in pharmaceutical rese...

Compound Q&A

Is 3-Cyclohexyl-1H-indole-6-carboxylic acid (CAS: 494799-17-6) safe?

3-Cyclohexyl-1H-indole-6-carboxylic acid (CAS: 494799-17-6) can be handled safely with appropriate p...

Compound Q&A

How should 3-Cyclohexyl-1H-indole-6-carboxylic acid (CAS: 494799-17-6) be stored?

3-Cyclohexyl-1H-indole-6-carboxylic acid (CAS: 494799-17-6) should be stored in a cool, dry place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...