Compound Q&A

What are the main uses of (2,5-Difluoro-4-methoxyphenyl)boronic acid (CAS: 897958-93-9)?

Answer

(2,5-Difluoro-4-methoxyphenyl)boronic acid
(2,5-Difluoro-4-methoxyphenyl)boronic acid is primarily used as a key intermediate in the synthesis of pharmaceuticals and agrochemicals. It also plays a role in the development of new materials and in organic chemistry research as a boronic acid derivative. Its use is mainly in the preparation of various boron-containing compounds for industrial and scientific applications.

About

English Name (2,5-Difluoro-4-methoxyphenyl)boronic acid
Molecular Formula C7H7BF2O3
Molecular Weight 187.94 g/mol
SMILES COC1=C(F)C=C(B(O)O)C(F)=C1
InChIKey BRMUXDWCSVTVPQ-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What is (2,5-Difluoro-4-methoxyphenyl)boronic acid (CAS: 897958-93-9)?

(2,5-Difluoro-4-methoxyphenyl)boronic acid is an organoboronic acid derivative with the molecular fo...

Compound Q&A

Is (2,5-Difluoro-4-methoxyphenyl)boronic acid (CAS: 897958-93-9) safe?

(2,5-Difluoro-4-methoxyphenyl)boronic acid is generally considered safe when handled properly. Howev...

Compound Q&A

How should (2,5-Difluoro-4-methoxyphenyl)boronic acid (CAS: 897958-93-9) be stored?

(2,5-Difluoro-4-methoxyphenyl)boronic acid should be stored in a cool, dry place, away from heat and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...