Compound Q&A

Is 2,5-Selenophenediylbis(trimethylstannane) (CAS: 220770-41-2) safe?

Answer

2,5-Selenophenediylbis(trimethylstannane)
2,5-Selenophenediylbis(trimethylstannane) (CAS: 220770-41-2) is generally considered safe when handled under proper laboratory conditions. However, it should be used with caution due to its reactivity. Protective measures include wearing appropriate gloves and goggles, and ensuring adequate ventilation.

About

English Name 2,5-Selenophenediylbis(trimethylstannane)
Molecular Formula C10H20SeSn2
Molecular Weight 456.65 g/mol
SMILES C[Sn](C)(C)c1ccc([se]1)[Sn](C)(C)C
InChIKey DTJBEISROOTMQK-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What is 2,5-Selenophenediylbis(trimethylstannane) (CAS: 220770-41-2)?

2,5-Selenophenediylbis(trimethylstannane) (CAS: 220770-41-2) is an organoaromatic selenide compound ...

Compound Q&A

What are the main uses of 2,5-Selenophenediylbis(trimethylstannane) (CAS: 220770-41-2)?

2,5-Selenophenediylbis(trimethylstannane) (CAS: 220770-41-2) is primarily used as a precursor in org...

Compound Q&A

How should 2,5-Selenophenediylbis(trimethylstannane) (CAS: 220770-41-2) be stored?

2,5-Selenophenediylbis(trimethylstannane) (CAS: 220770-41-2) should be stored in a cool, dry place a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...