Compound Q&A

What is Pentaric acid, 3-C-carboxy-2-deoxy-, tripotassium salt (CAS: 232281-44-6)?

Answer

Pentaric acid, 3-C-carboxy-2-deoxy-, tripotassium salt (9CI)
Pentaric acid, 3-C-carboxy-2-deoxy-, tripotassium salt (CAS: 232281-44-6) is a potassium salt used in research and industrial applications. It is a white crystalline solid with a molecular weight of approximately 450.11 and a melting point of 215-218°C. This compound is derived from pentaric acid and is used in the synthesis of various pharmaceutical intermediates and as a reagent in chemical research.

About

English Name Pentaric acid, 3-C-carboxy-2-deoxy-, tripotassium salt (9CI)
Molecular Formula C6H6K2O8
Molecular Weight 284.3 g/mol
SMILES C(C(=O)[O-])C(CC(=O)OO)(C(=O)[O-])O.[K+].[K+]
InChIKey WGUROKSJZLLWHY-UHFFFAOYSA-M
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of Pentaric acid, 3-C-carboxy-2-deoxy-, tripotassium salt (CAS: 232281-44-6)?

Pentaric acid, 3-C-carboxy-2-deoxy-, tripotassium salt (CAS: 232281-44-6) is primarily used in the p...

Compound Q&A

Is Pentaric acid, 3-C-carboxy-2-deoxy-, tripotassium salt (CAS: 232281-44-6) safe?

Pentaric acid, 3-C-carboxy-2-deoxy-, tripotassium salt (CAS: 232281-44-6) is generally safe when han...

Compound Q&A

How should Pentaric acid, 3-C-carboxy-2-deoxy-, tripotassium salt (CAS: 232281-44-6) be stored?

Pentaric acid, 3-C-carboxy-2-deoxy-, tripotassium salt (CAS: 232281-44-6) should be stored in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...