Compound Q&A

What are the main uses of 1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate (CAS: 126401-22-7)?

Answer

1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate
1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It is also utilized in industrial applications such as coatings, adhesives, and as a reagent in research due to its chemical versatility.

About

English Name 1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate
Molecular Formula C16H21NO4
Molecular Weight 291.35 g/mol
SMILES CCOC(=O)C1CCCCN1C(=O)OCC2=CC=CC=C2
InChIKey OYIRYYMFKGTFJE-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What is 1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate (CAS: 126401-22-7)?

1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate is a chemical compound with the CAS number 126401-22-7...

Compound Q&A

Is 1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate (CAS: 126401-22-7) safe?

1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate is generally safe when handled with appropriate precau...

Compound Q&A

How should 1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate (CAS: 126401-22-7) be stored?

1-Benzyl 2-ethyl piperidine-1,2-dicarboxylate should be stored in a cool, dry place to prevent degra...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...