Compound Q&A

What is 4-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 889939-25-7)?

Answer

4-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-B]pyridine
4-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 889939-25-7) is an organic compound with a molecular formula C14H10BrN3O2S. It is characterized by its aromatic structure and features high solubility in organic solvents. This compound exhibits unique chemical properties making it suitable for various applications in pharmaceuticals, research, and other industries.

About

English Name 4-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-B]pyridine
Molecular Formula C13H9BrN2O2S
Molecular Weight 337.19800000000004 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(C=CN=C32)Br
InChIKey HSCQVANUQCLSJL-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of 4-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 889939-25-7)?

4-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 889939-25-7) is primarily used in pharmac...

Compound Q&A

Is 4-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 889939-25-7) safe?

4-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 889939-25-7) is generally safe when handl...

Compound Q&A

How should 4-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 889939-25-7) be stored?

4-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 889939-25-7) should be stored in a tightl...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...