Compound Q&A

What is Benzyl (2S)-2-methyl-1-piperazinecarboxylate hydrochloride (CAS: 1217720-49-4)?

Answer

Benzyl (2S)-2-methyl-1-piperazinecarboxylate hydrochloride (1:1)
Benzyl (2S)-2-methyl-1-piperazinecarboxylate hydrochloride (CAS: 1217720-49-4) is a chemical compound used in pharmaceutical and medicinal applications. It is a salt derived from a benzyl ester and a piperazine derivative with a hydrochloride counterion.

About

English Name Benzyl (2S)-2-methyl-1-piperazinecarboxylate hydrochloride (1:1)
Molecular Formula C13H19ClN2O2
Molecular Weight 270.76 g/mol
SMILES C[C@H]1CNCCN1C(=O)OCc2ccccc2.Cl
InChIKey WQPQNIUAWYRGJF-MERQFXBCSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of Benzyl (2S)-2-methyl-1-piperazinecarboxylate hydrochloride (CAS: 1217720-49-4)?

Benzyl (2S)-2-methyl-1-piperazinecarboxylate hydrochloride is primarily used in the production of ph...

Compound Q&A

Is Benzyl (2S)-2-methyl-1-piperazinecarboxylate hydrochloride (CAS: 1217720-49-4) safe?

Benzyl (2S)-2-methyl-1-piperazinecarboxylate hydrochloride is generally considered safe when handled...

Compound Q&A

How should Benzyl (2S)-2-methyl-1-piperazinecarboxylate hydrochloride (CAS: 1217720-49-4) be stored?

Benzyl (2S)-2-methyl-1-piperazinecarboxylate hydrochloride should be stored in a cool, dry place, aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...