Compound Q&A

What is Potassium hydrogen ethanedioate - ethanedioic acid (1:1:1) (CAS: 127-96-8)?

Answer

Potassium hydrogen ethanedioate - ethanedioic acid (1:1:1)
Potassium hydrogen ethanedioate - ethanedioic acid (1:1:1) (CAS: 127-96-8) is a chemical compound with the formula KHC2O4. It is a salt formed by combining potassium hydrogen carbonate and oxalic acid. This compound is commonly used in various applications due to its properties such as dissociation in aqueous solutions and stability under certain conditions.

About

CAS No 127-96-8
English Name Potassium hydrogen ethanedioate - ethanedioic acid (1:1:1)
Molecular Formula C4H3KO8
Molecular Weight 218.16 g/mol
SMILES C(=O)(C(=O)O)O.C(=O)(C(=O)[O-])O.[K+]
InChIKey GANDVAJEIJXBQJ-UHFFFAOYSA-M
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of Potassium hydrogen ethanedioate - ethanedioic acid (1:1:1) (CAS: 127-96-8)?

Potassium hydrogen ethanedioate - ethanedioic acid (1:1:1) (CAS: 127-96-8) is widely used in pharmac...

Compound Q&A

Is Potassium hydrogen ethanedioate - ethanedioic acid (1:1:1) (CAS: 127-96-8) safe?

Potassium hydrogen ethanedioate - ethanedioic acid (1:1:1) (CAS: 127-96-8) is generally considered s...

Compound Q&A

How should Potassium hydrogen ethanedioate - ethanedioic acid (1:1:1) (CAS: 127-96-8) be stored?

Potassium hydrogen ethanedioate - ethanedioic acid (1:1:1) (CAS: 127-96-8) should be stored in a tig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...