Compound Q&A

What is 7-Fluoro-2,1,3-benzoxadiazole-4-sulfonic acid ammoniate (CAS: 84806-27-9)?

Answer

7-Fluoro-2,1,3-benzoxadiazole-4-sulfonic acid ammoniate (1:1)
7-Fluoro-2,1,3-benzoxadiazole-4-sulfonic acid ammoniate (CAS: 84806-27-9) is an organic compound with the chemical formula C7H6FN2O4S. It has a molecular weight of 223.22 g/mol and is a white or off-white crystalline solid. This compound is characterized by its solubility in water and its stability under normal conditions.

About

CAS No 84806-27-9
English Name 7-Fluoro-2,1,3-benzoxadiazole-4-sulfonic acid ammoniate (1:1)
Molecular Formula C6H6FN3O4S
Molecular Weight 235.19 g/mol
SMILES O=S(C1=CC=C(F)C2=NON=C12)([O-])=O.[NH4+]
InChIKey JXLHNMVSKXFWAO-UHFFFAOYSA-N
Last Updated: 2025-11-04 07:37

Related Q&A

Compound Q&A

What are the main uses of 7-Fluoro-2,1,3-benzoxadiazole-4-sulfonic acid ammoniate (CAS: 84806-27-9)?

7-Fluoro-2,1,3-benzoxadiazole-4-sulfonic acid ammoniate (CAS: 84806-27-9) is primarily used in the p...

Compound Q&A

Is 7-Fluoro-2,1,3-benzoxadiazole-4-sulfonic acid ammoniate (CAS: 84806-27-9) safe?

7-Fluoro-2,1,3-benzoxadiazole-4-sulfonic acid ammoniate (CAS: 84806-27-9) is generally safe when han...

Compound Q&A

How should 7-Fluoro-2,1,3-benzoxadiazole-4-sulfonic acid ammoniate (CAS: 84806-27-9) be stored?

7-Fluoro-2,1,3-benzoxadiazole-4-sulfonic acid ammoniate (CAS: 84806-27-9) should be stored in tightl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...