Compound Q&A

Are there alternatives to potassium (2,4-difluorophenyl)(trifluoro)borate(1-) (CAS: 871231-41-3) in synthesis?

Answer

Potassium (2,4-difluorophenyl)(trifluoro)borate(1-)
Alternatives to potassium (2,4-difluorophenyl)(trifluoro)borate(1-) in synthesis include other organoboranes such as triphenylborane or tributylborate. These can serve similar roles depending on the specific reaction conditions and desired product.

About

English Name Potassium (2,4-difluorophenyl)(trifluoro)borate(1-)
Molecular Formula C6H3BF5K
Molecular Weight 219.99 g/mol
SMILES [B-](C1=C(C=C(C=C1)F)F)(F)(F)F.[K+]
InChIKey HZKKNPYRMYVEOW-UHFFFAOYSA-N
Last Updated: 2025-11-03 09:36

Related Q&A

Compound Q&A

What regulatory guidelines apply to potassium (2,4-difluorophenyl)(trifluoro)borate(1-) (CAS: 871231-41-3)?

Potassium (2,4-difluorophenyl)(trifluoro)borate(1-) (CAS: 871231-41-3) should comply with the Global...

Compound Q&A

What is the market or research trend for potassium (2,4-difluorophenyl)(trifluoro)borate(1-) (CAS: 871231-41-3)?

The market for potassium (2,4-difluorophenyl)(trifluoro)borate(1-) is growing as it finds applicatio...

Compound Q&A

How should waste containing potassium (2,4-difluorophenyl)(trifluoro)borate(1-) (CAS: 871231-41-3) be handled?

Waste containing potassium (2,4-difluorophenyl)(trifluoro)borate(1-) should be collected in appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...