Compound Q&A

Are there alternatives to (2S)-2-Aminooctanedioic acid in synthesis?

Answer

(2S)-2-Aminooctanedioic acid
Several alternatives can be used in the synthesis of (2S)-2-Aminooctanedioic acid. Common substitutes include other dicarboxylic acids such as adipic acid or succinic acid, which can serve as precursors for similar chemical reactions. Additionally, synthetic methods using amino acids or their derivatives can provide similar functionalities, though the specific choice depends on the desired application and reaction conditions.

About

CAS No 4254-88-0
English Name (2S)-2-Aminooctanedioic acid
Molecular Formula C8H15NO4
Molecular Weight 189.21 g/mol
SMILES OC(=O)CCCCC[C@@H](C(=O)O)N
InChIKey YOFPFYYTUIARDI-LURJTMIESA-N
Last Updated: 2025-11-03 09:36

Related Q&A

Compound Q&A

What regulatory guidelines apply to (2S)-2-Aminooctanedioic acid (CAS: 4254-88-0)?

The (2S)-2-Aminooctanedioic acid (CAS: 4254-88-0) falls under the European Union's REACH regulation,...

Compound Q&A

What is the market or research trend for (2S)-2-Aminooctanedioic acid?

The market for (2S)-2-Aminooctanedioic acid is steadily growing due to its application in biodegrada...

Compound Q&A

How should waste containing (2S)-2-Aminooctanedioic acid be handled?

Waste containing (2S)-2-Aminooctanedioic acid should be collected in appropriate containers and prop...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...