Compound Q&A

How is 2-Chloro-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]acetamide (CAS: 14405-03-9) typically synthesized?

Answer

2-Chloro-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]acetamide
2-Chloro-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]acetamide (CAS: 14405-03-9) is synthesized by reacting 2-chlorobenzoyl chloride with 4-chloroacetanilide in the presence of an acid catalyst such as sulfuric acid. The reaction typically yields a mixture of products, and selective purification is required to obtain the pure compound.

About

CAS No 14405-03-9
English Name 2-Chloro-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]acetamide
Molecular Formula C15H10Cl3NO2
Molecular Weight 342.61 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Cl)NC(=O)CCl)Cl
InChIKey VCBRYYAFVLDIHK-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]acetamide (CAS: 14405-03-9)?

2-Chloro-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]acetamide (CAS: 14405-03-9) is a crystalline solid wi...

Compound Q&A

What industries use 2-Chloro-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]acetamide (CAS: 14405-03-9)?

2-Chloro-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]acetamide (CAS: 14405-03-9) is used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 2-Chloro-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]acetamide (CAS: 14405-03-9)?

When handling 2-Chloro-N-[4-chloro-2-(2-chlorobenzoyl)phenyl]acetamide (CAS: 14405-03-9), it is esse...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...