Compound Q&A

What are the physical and chemical properties of 2,3,4,5-Tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid (CAS: 76280-91-6)?

Answer

2,3,4,5-Tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid
2,3,4,5-Tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid is a crystalline solid with a molecular weight of approximately 516.91 g/mol. It has a low solubility in water but is more soluble in organic solvents. Chemically, it is highly reactive due to the presence of chlorine atoms and a carbamoyl group. It is a potent inhibitor and can be used in various chemical reactions.

About

CAS No 76280-91-6
English Name 2,3,4,5-Tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid
Molecular Formula C14H5Cl6NO3
Molecular Weight 447.92 g/mol
SMILES C1=CC(=C(C(=C1)Cl)Cl)NC(=O)C2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)C(=O)O
InChIKey ROZUQUDEWZIBHV-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 2,3,4,5-Tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid (CAS: 76280-91-6) typically synthesized?

2,3,4,5-Tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid is typically synthesized through a...

Compound Q&A

What industries use 2,3,4,5-Tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid (CAS: 76280-91-6)?

2,3,4,5-Tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid is primarily used in pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2,3,4,5-Tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid (CAS: 76280-91-6)?

Handling 2,3,4,5-Tetrachloro-6-[(2,3-dichlorophenyl)carbamoyl]benzoic acid requires strict safety me...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...