Compound Q&A

What industries use Corticotropin Releasing Factor bovine (CAS: 92307-52-3)?

Answer

Corticotropin Releasing Factor bovine
Corticotropin Releasing Factor bovine (CAS: 92307-52-3) is primarily used in the pharmaceutical industry for research and development of drugs targeting the hypothalamic-pituitary-adrenal (HPA) axis. It is also used in the biotechnology industry for the production of recombinant proteins and in sensor applications for detecting stress responses.

About

CAS No 92307-52-3
English Name Corticotropin Releasing Factor bovine
Molecular Formula C206H340N60O63S
Molecular Weight 4697 g/mol
SMILES CCC(C)C(C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC(=O)O)C(=O)NC(CC(C)C)C(=O)NC(C(C)O)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CC2=CNC=N2)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCC(=O)O)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(CCSC)C(=O)NC(C(C)O)C(=O)NC(CCCCN)C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)C(=O)NC(C)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(C)C(=O)NC(CC3=CNC=N3)C(=O)NC(CC(=O)N)C(=O)NC(CC(=O)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CC(=O)O)C(=O)NC(C(C)CC)C(=O)NC(C)C(=O)N)NC(=O)C4CCCN4C(=O)C5CCCN5C(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C(CO)N
InChIKey BMUPKVLWWGQTIL-SFYWBPHXSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Corticotropin Releasing Factor bovine (CAS: 92307-52-3)?

Corticotropin Releasing Factor bovine (CAS: 92307-52-3) is a small peptide with a molecular weight o...

Compound Q&A

How is Corticotropin Releasing Factor bovine (CAS: 92307-52-3) typically synthesized?

Corticotropin Releasing Factor bovine (CAS: 92307-52-3) is typically synthesized using solid-phase p...

Compound Q&A

What precautions should be taken when handling Corticotropin Releasing Factor bovine (CAS: 92307-52-3)?

When handling Corticotropin Releasing Factor bovine (CAS: 92307-52-3), appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...