Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate (CAS: 1292268-13-3)?

Answer

2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate
2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate is a white crystalline solid with a molecular weight of approximately 508.62 g/mol. It has low solubility in water but is soluble in organic solvents like ethanol and acetone. This compound exhibits moderate reactivity, particularly in ester and carbamate functionalities, making it useful in various chemical reactions. It is stable under normal conditions but should be protected from strong acids and bases to prevent degradation.

About

English Name 2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate
Molecular Formula C19H39NO9
Molecular Weight 425.52 g/mol
SMILES OCCOCCOCCOCCOCCOCCOCCNC(=O)OC(C)(C)C
InChIKey FOYKHCLPZWXBOB-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate (CAS: 1292268-13-3) typically synthesized?

2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate is typically synthesized t...

Compound Q&A

What industries use 2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate (CAS: 1292268-13-3)?

2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate is used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate (CAS: 1292268-13-3)?

Handling 2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate requires the use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...