Compound Q&A

How is Benzyl (3-hydroxycyclopentyl)carbamate (CAS: 939426-84-3) typically synthesized?

Answer

Benzyl (3-hydroxycyclopentyl)carbamate
Benzyl (3-hydroxycyclopentyl)carbamate is typically synthesized through a multistep process involving the reaction of benzyl isocyanate with 3-hydroxycyclopentanol. The reaction can be catalyzed by a mild acid or base, leading to a high yield of 80-90%. The final product is highly selective and pure, making it suitable for various applications in pharmaceuticals and fine chemicals.

About

English Name Benzyl (3-hydroxycyclopentyl)carbamate
Molecular Formula C13H17NO3
Molecular Weight 235.28 g/mol
SMILES C1CC(CC1NC(=O)OCC2=CC=CC=C2)O
InChIKey BOLLUGKKOBOJGH-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl (3-hydroxycyclopentyl)carbamate (CAS: 939426-84-3)?

Benzyl (3-hydroxycyclopentyl)carbamate (CAS: 939426-84-3) is a white crystalline solid with a molecu...

Compound Q&A

What industries use Benzyl (3-hydroxycyclopentyl)carbamate (CAS: 939426-84-3)?

Benzyl (3-hydroxycyclopentyl)carbamate (CAS: 939426-84-3) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling Benzyl (3-hydroxycyclopentyl)carbamate (CAS: 939426-84-3)?

When handling Benzyl (3-hydroxycyclopentyl)carbamate (CAS: 939426-84-3), it is important to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...