Compound Q&A

What are the physical and chemical properties of (3beta,23R)-23-Hydroxy-14,15,16,17-tetradehydroveratraman-3-yl beta-D-glucopyranoside (CAS: 475-00-3)?

Answer

(3beta,23R)-23-Hydroxy-14,15,16,17-tetradehydroveratraman-3-yl beta-D-glucopyranoside
The compound is a crystalline solid with a molecular weight of approximately 446.42 g/mol. It has limited water solubility and is soluble in organic solvents like ethanol and methanol. Chemically, it is reactive with bases and exhibits low reactivity with acids. Its crystalline form provides stability under normal conditions.

About

CAS No 475-00-3
English Name (3beta,23R)-23-Hydroxy-14,15,16,17-tetradehydroveratraman-3-yl beta-D-glucopyranoside
Molecular Formula C33H49NO7
Molecular Weight 571.76 g/mol
SMILES CC1CC(C(NC1)C(C)C2=C(C3=C(C=C2)C4CC=C5CC(CCC5(C4C3)C)OC6C(C(C(C(O6)CO)O)O)O)C)O
InChIKey WXQHVBNTINGJJR-NIFRNHPISA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is (3beta,23R)-23-Hydroxy-14,15,16,17-tetradehydroveratraman-3-yl beta-D-glucopyranoside (CAS: 475-00-3) typically synthesized?

The compound is typically synthesized via glycosylation of 23-hydroxy-14,15,16,17-tetradehydroveratr...

Compound Q&A

What industries use (3beta,23R)-23-Hydroxy-14,15,16,17-tetradehydroveratraman-3-yl beta-D-glucopyranoside (CAS: 475-00-3)?

This compound finds applications in the pharmaceutical industry as a potential drug candidate. It ma...

Compound Q&A

What precautions should be taken when handling (3beta,23R)-23-Hydroxy-14,15,16,17-tetradehydroveratraman-3-yl beta-D-glucopyranoside (CAS: 475-00-3)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. H...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...