Compound Q&A

What are the physical and chemical properties of 2,7-Di(4-pyridinyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone (CAS: 34151-49-0)?

Answer

2,7-Di(4-pyridinyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone
2,7-Di(4-pyridinyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone is a crystalline compound with a molecular weight of approximately 528.3 g/mol. It has low water solubility and moderate solubility in organic solvents like ethanol and dimethylformamide. It is known for its redox activity and stability, making it a reactive compound in redox reactions and coordination chemistry.

About

CAS No 34151-49-0
English Name 2,7-Di(4-pyridinyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone
Molecular Formula C24H12N4O4
Molecular Weight 420.38 g/mol
SMILES O=C(N(C1=CC=NC=C1)C(C2=C3C4=C(C(N5C6=CC=NC=C6)=O)C=C2)=O)C3=CC=C4C5=O
InChIKey IBRPEOCBRYYINT-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 2,7-Di(4-pyridinyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone (CAS: 34151-49-0) typically synthesized?

This compound is typically synthesized through a multi-step process involving the condensation of 4-...

Compound Q&A

What industries use 2,7-Di(4-pyridinyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone (CAS: 34151-49-0)?

2,7-Di(4-pyridinyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone is used in various industrie...

Compound Q&A

What precautions should be taken when handling 2,7-Di(4-pyridinyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone (CAS: 34151-49-0)?

Proper handling of 2,7-Di(4-pyridinyl)benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone requires ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...