Compound Q&A

How is Butadiene, styrene, acrylic acid latex (CAS: 25085-39-6) typically synthesized?

Answer

Butadiene, styrene, acrylic acid latex
Butadiene, styrene, acrylic acid latex (CAS: 25085-39-6) is typically synthesized through emulsion polymerization. The process involves the addition of monomers such as butadiene, styrene, and acrylic acid into an aqueous medium in the presence of water-soluble initiators and emulsifiers. Commonly used initiators include potassium persulfate. The reaction is usually carried out under mild conditions to ensure high selectivity and yield.

About

CAS No 25085-39-6
English Name Butadiene, styrene, acrylic acid latex
Molecular Formula C15H18O2
Molecular Weight 230.31 g/mol
SMILES C=CC=C.C=CC1=CC=CC=C1.C=CC(=O)O
InChIKey PLOYJEGLPVCRAJ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Butadiene, styrene, acrylic acid latex (CAS: 25085-39-6)?

Butadiene, styrene, acrylic acid latex (CAS: 25085-39-6) is a latex composed of a mixture of butadie...

Compound Q&A

What industries use Butadiene, styrene, acrylic acid latex (CAS: 25085-39-6)?

Butadiene, styrene, acrylic acid latex (CAS: 25085-39-6) is widely used in the manufacturing of adhe...

Compound Q&A

What precautions should be taken when handling Butadiene, styrene, acrylic acid latex (CAS: 25085-39-6)?

When handling Butadiene, styrene, acrylic acid latex (CAS: 25085-39-6), it is essential to use perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...