Compound Q&A

What industries use (6-Phenyl-3-pyridinyl)boronic acid (CAS: 155079-10-0)?

Answer

(6-Phenyl-3-pyridinyl)boronic acid
(6-Phenyl-3-pyridinyl)boronic acid (CAS: 155079-10-0) is widely used in the pharmaceutical industry for the synthesis of complex organic molecules and in the polymer industry for the development of functional materials. It also finds applications in the sensor technology and semiconductor industries, where its unique properties contribute to the formation of stable and functional materials.

About

English Name (6-Phenyl-3-pyridinyl)boronic acid
Molecular Formula C11H10BNO2
Molecular Weight 199.02 g/mol
SMILES B(C1=CN=C(C=C1)C2=CC=CC=C2)(O)O
InChIKey XSQUPVXOENTCJV-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6-Phenyl-3-pyridinyl)boronic acid (CAS: 155079-10-0)?

(6-Phenyl-3-pyridinyl)boronic acid (CAS: 155079-10-0) is a white crystalline solid with a molecular ...

Compound Q&A

How is (6-Phenyl-3-pyridinyl)boronic acid (CAS: 155079-10-0) typically synthesized?

(6-Phenyl-3-pyridinyl)boronic acid (CAS: 155079-10-0) can be synthesized via a multistep process, st...

Compound Q&A

What precautions should be taken when handling (6-Phenyl-3-pyridinyl)boronic acid (CAS: 155079-10-0)?

When handling (6-Phenyl-3-pyridinyl)boronic acid (CAS: 155079-10-0), it is important to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...