Compound Q&A

What are the physical and chemical properties of 3-[2,4-Dichloro-5-(2-propyn-1-yloxy)phenyl]-5-(2-methyl-2-propanyl)-1,3,4-oxadiazol-2(3H)-one (CAS: 39807-15-3)?

Answer

3-[2,4-Dichloro-5-(2-propyn-1-yloxy)phenyl]-5-(2-methyl-2-propanyl)-1,3,4-oxadiazol-2(3H)-one
The compound has a crystalline form and a molecular weight of approximately 410.04 g/mol. It is slightly soluble in water but highly soluble in common organic solvents like DMSO and acetonitrile. Chemically, it is reactive towards nucleophiles and shows good stability under neutral and slightly acidic conditions. It is less reactive towards oxidizing agents and bases.

About

CAS No 39807-15-3
English Name 3-[2,4-Dichloro-5-(2-propyn-1-yloxy)phenyl]-5-(2-methyl-2-propanyl)-1,3,4-oxadiazol-2(3H)-one
Molecular Formula C15H14Cl2N2O3
Molecular Weight 341.19 g/mol
EINECS 254-637-6
SMILES O=C1OC(C(C)(C)C)=NN1C2=CC(OCC#C)=C(Cl)C=C2Cl
InChIKey DVOODWOZJVJKQR-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 3-[2,4-Dichloro-5-(2-propyn-1-yloxy)phenyl]-5-(2-methyl-2-propanyl)-1,3,4-oxadiazol-2(3H)-one (CAS: 39807-15-3) typically synthesized?

This compound is typically synthesized via a multistep process involving a Grignard reaction followe...

Compound Q&A

What industries use 3-[2,4-Dichloro-5-(2-propyn-1-yloxy)phenyl]-5-(2-methyl-2-propanyl)-1,3,4-oxadiazol-2(3H)-one (CAS: 39807-15-3)?

This compound is used in the pharmaceutical industry for its potential as a precursor in drug synthe...

Compound Q&A

What precautions should be taken when handling 3-[2,4-Dichloro-5-(2-propyn-1-yloxy)phenyl]-5-(2-methyl-2-propanyl)-1,3,4-oxadiazol-2(3H)-one (CAS: 39807-15-3)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...