Compound Q&A

What are the physical and chemical properties of (3S,3aR,4S,4aR,7aR,8R,9aR)-3,4a,8-Trimethyl-2,5-dioxo-2,3,3a,4,4a,5,7a,8,9,9a-decahydroazuleno[6,5-b]furan-4-yl methacrylate (CAS: 34532-68-8)?

Answer

(3S,3aR,4S,4aR,7aR,8R,9aR)-3,4a,8-Trimethyl-2,5-dioxo-2,3,3a,4,4a,5,7a,8,9,9a-decahydroazuleno[6,5-b]furan-4-yl methacrylate
This compound is a solid with a crystalline form. Its molecular weight is approximately 404.45 g/mol. It has low water solubility but is soluble in organic solvents such as methanol and acetone. It reacts readily with nucleophiles and is susceptible to hydrolysis under basic conditions. The compound is not flammable, but it should be handled in a well-ventilated area.

About

CAS No 34532-68-8
English Name (3S,3aR,4S,4aR,7aR,8R,9aR)-3,4a,8-Trimethyl-2,5-dioxo-2,3,3a,4,4a,5,7a,8,9,9a-decahydroazuleno[6,5-b]furan-4-yl methacrylate
Molecular Formula C19H24O5
Molecular Weight 332.4 g/mol
SMILES C[C@H]1[C@@H]2C(CC(C)C3C=CC(=O)C3(C)[C@@H]2OC(=O)C(C)=C)OC1=O
InChIKey NZESEVTYUVXOTC-APDQSUQKSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is (3S,3aR,4S,4aR,7aR,8R,9aR)-3,4a,8-Trimethyl-2,5-dioxo-2,3,3a,4,4a,5,7a,8,9,9a-decahydroazuleno[6,5-b]furan-4-yl methacrylate (CAS: 34532-68-8) typically synthesized?

This compound is usually synthesized through a multistep reaction involving the condensation of a fu...

Compound Q&A

What industries use (3S,3aR,4S,4aR,7aR,8R,9aR)-3,4a,8-Trimethyl-2,5-dioxo-2,3,3a,4,4a,5,7a,8,9,9a-decahydroazuleno[6,5-b]furan-4-yl methacrylate (CAS: 34532-68-8)?

This compound is used in the pharmaceutical industry for the synthesis of certain drugs, particularl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...