Compound Q&A

What precautions should be taken when handling 25-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosan-1-oic acid (CAS: 1334177-79-5)?

Answer

25-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosan-1-oic acid
When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Work should be conducted in a fume hood to minimize inhalation risks. In case of a spill, consult the Safety Data Sheet (SDS) for specific cleanup procedures, and ensure proper disposal of waste materials.

About

English Name 25-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosan-1-oic acid
Molecular Formula C22H36N2O11
Molecular Weight 504.53 g/mol
SMILES O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCOCCOCCOCCOCCC(=O)O C22H36N2O11
InChIKey WKTGEZMXNNBFEZ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 25-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosan-1-oic acid (CAS: 1334177-79-5)?

This compound is a crystalline solid with a high molecular weight and moderate solubility in polar s...

Compound Q&A

How is 25-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosan-1-oic acid (CAS: 1334177-79-5) typically synthesized?

This compound can be synthesized through the condensation of appropriate precursors under anhydrous ...

Compound Q&A

What industries use 25-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosan-1-oic acid (CAS: 1334177-79-5)?

This compound finds applications in pharmaceuticals, where its structural complexity allows for the ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...