Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(2S)-2-morpholinylmethyl]carbamate (CAS: 875551-59-0)?

Answer

2-Methyl-2-propanyl [(2S)-2-morpholinylmethyl]carbamate
2-Methyl-2-propanyl [(2S)-2-morpholinylmethyl]carbamate is a colorless to white crystalline solid with a molecular weight of approximately 241.41 g/mol. It is soluble in organic solvents such as methanol and ethanol but has low water solubility. This compound is reactive under acidic or basic conditions and is susceptible to hydrolysis. It has a melting point range of 62-64°C and a boiling point above 200°C.

About

English Name 2-Methyl-2-propanyl [(2S)-2-morpholinylmethyl]carbamate
Molecular Formula C10H20N2O3
Molecular Weight 216.28 g/mol
SMILES CC(C)(C)OC(=O)NC[C@@H]1CNCCO1
InChIKey IYHJNCQAADULQE-QMMMGPOBSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl [(2S)-2-morpholinylmethyl]carbamate (CAS: 875551-59-0) typically synthesized?

2-Methyl-2-propanyl [(2S)-2-morpholinylmethyl]carbamate can be synthesized via a multistep process i...

Compound Q&A

What industries use 2-Methyl-2-propanyl [(2S)-2-morpholinylmethyl]carbamate (CAS: 875551-59-0)?

2-Methyl-2-propanyl [(2S)-2-morpholinylmethyl]carbamate is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [(2S)-2-morpholinylmethyl]carbamate (CAS: 875551-59-0)?

When handling 2-Methyl-2-propanyl [(2S)-2-morpholinylmethyl]carbamate, it is essential to use proper...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...