Compound Q&A

What are the physical and chemical properties of 2,9-Bis(2,6-diisopropylphenyl)isoquinolino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone (CAS: 82953-57-9)?

Answer

2,9-Bis(2,6-diisopropylphenyl)isoquinolino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone
The compound has a crystalline form with a high molecular weight. It is poorly soluble in common organic solvents but exhibits good solubility in non-polar solvents. Chemically, it is rather stable but can react under certain conditions, particularly with strong acids or bases. Its exact reactivity profile depends on the specific environment and conditions.

About

CAS No 82953-57-9
English Name 2,9-Bis(2,6-diisopropylphenyl)isoquinolino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone
Molecular Formula C48H42N2O4
Molecular Weight 710.87 g/mol
SMILES CC(c1cccc(c1n1c(=O)c2ccc3c4c2c(c1=O)ccc4c1c2c3ccc3c2c(cc1)c(=O)n(c3=O)c1c(cccc1C(C)C)C(C)C)C(C)C)C
InChIKey NAZODJSYHDYJGP-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 2,9-Bis(2,6-diisopropylphenyl)isoquinolino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone (CAS: 82953-57-9) typically synthesized?

The compound is synthesized through a multi-step process involving the coupling of isoquinoline and ...

Compound Q&A

What industries use 2,9-Bis(2,6-diisopropylphenyl)isoquinolino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone (CAS: 82953-57-9)?

This compound is primarily used in the pharmaceutical industry for its potential medicinal applicati...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...