Compound Q&A

What precautions should be taken when handling (2E)-3-Phenyl-2-propen-1-yl (2E)-2-cyano-3-(3,4-dihydroxyphenyl)acrylate (CAS: 132465-11-3)?

Answer

(2E)-3-Phenyl-2-propen-1-yl (2E)-2-cyano-3-(3,4-dihydroxyphenyl)acrylate
When handling (2E)-3-Phenyl-2-propen-1-yl (2E)-2-cyano-3-(3,4-dihydroxyphenyl)acrylate (CAS 132465-11-3), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a dry, cool place away from direct sunlight. In case of a spill, neutralize the compound with a suitable absorbent and dispose of it according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed information on handling and disposal.

About

English Name (2E)-3-Phenyl-2-propen-1-yl (2E)-2-cyano-3-(3,4-dihydroxyphenyl)acrylate
Molecular Formula C19H15NO4
Molecular Weight 17.03 g/mol
SMILES N#C/C(=C\c1ccc(c(c1)O)O)/C(=O)OCC=Cc1ccccc1
InChIKey XGHYFEJMJXGPGN-UYHGDYIZSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2E)-3-Phenyl-2-propen-1-yl (2E)-2-cyano-3-(3,4-dihydroxyphenyl)acrylate (CAS: 132465-11-3)?

The compound (2E)-3-Phenyl-2-propen-1-yl (2E)-2-cyano-3-(3,4-dihydroxyphenyl)acrylate (CAS 132465-11...

Compound Q&A

How is (2E)-3-Phenyl-2-propen-1-yl (2E)-2-cyano-3-(3,4-dihydroxyphenyl)acrylate (CAS: 132465-11-3) typically synthesized?

The compound (2E)-3-Phenyl-2-propen-1-yl (2E)-2-cyano-3-(3,4-dihydroxyphenyl)acrylate (CAS 132465-11...

Compound Q&A

What industries use (2E)-3-Phenyl-2-propen-1-yl (2E)-2-cyano-3-(3,4-dihydroxyphenyl)acrylate (CAS: 132465-11-3)?

The compound (2E)-3-Phenyl-2-propen-1-yl (2E)-2-cyano-3-(3,4-dihydroxyphenyl)acrylate (CAS 132465-11...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...