Compound Q&A

How is asphalatum (CAS: 8052-42-4) typically synthesized?

Answer

ASPHALTUM
Asphalatum (CAS: 8052-42-4) is typically obtained from the distillation of petroleum or can be extracted from natural sources like asphalt deposits. The synthesis involves a series of fractional distillations to separate and concentrate the heavier hydrocarbons. Catalytic cracking or pyrolysis of heavy petroleum fractions can also be used to produce asphalatum.

About

CAS No 8052-42-4
English Name ASPHALTUM
Molecular Formula C10H21F3O3SSi
Molecular Weight 306.42 g/mol
EINECS 232-490-9
SMILES S(C(F)(F)F)(=O)(=O)O[Si](C(C)C)(C(C)C)C(C)C
InChIKey LHJCZOXMCGQVDQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Asphalatum (CAS: 8052-42-4)?

Asphalatum (CAS: 8052-42-4) is a black to brown, amorphous solid with a high molecular weight. It is...

Compound Q&A

What industries use asphalatum (CAS: 8052-42-4)?

Asphalatum (CAS: 8052-42-4) is widely used in the construction industry for road paving and waterpro...

Compound Q&A

What precautions should be taken when handling asphalatum (CAS: 8052-42-4)?

When handling asphalatum (CAS: 8052-42-4), proper personal protective equipment (PPE) is essential, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...