Compound Q&A

What industries use 2,2'-[(4-Amino-3-nitrophenyl)imino]diethanol hydrochloride (CAS: 94158-13-1)?

Answer

2,2'-[(4-Amino-3-nitrophenyl)imino]diethanol hydrochloride (1:1)
2,2'-[(4-Amino-3-nitrophenyl)imino]diethanol hydrochloride (CAS: 94158-13-1) finds applications in the pharmaceutical industry, where it serves as an intermediate in the synthesis of various drugs. It is also used in the polymer industry for the fabrication of certain types of plastics and in the sensor industry for the development of chemical sensors. Its properties make it suitable for use in semiconductor manufacturing as well.

About

CAS No 94158-13-1
English Name 2,2'-[(4-Amino-3-nitrophenyl)imino]diethanol hydrochloride (1:1)
Molecular Formula C10H16ClN3O4
Molecular Weight 277.7 g/mol
SMILES O=[N+](C1=CC(N(CCO)CCO)=CC=C1N)[O-].[H]Cl
InChIKey ASAQRGCLIPUSEK-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-[(4-Amino-3-nitrophenyl)imino]diethanol hydrochloride (CAS: 94158-13-1)?

2,2'-[(4-Amino-3-nitrophenyl)imino]diethanol hydrochloride (CAS: 94158-13-1) is a crystalline compou...

Compound Q&A

How is 2,2'-[(4-Amino-3-nitrophenyl)imino]diethanol hydrochloride (CAS: 94158-13-1) typically synthesized?

2,2'-[(4-Amino-3-nitrophenyl)imino]diethanol hydrochloride (CAS: 94158-13-1) is typically synthesize...

Compound Q&A

What precautions should be taken when handling 2,2'-[(4-Amino-3-nitrophenyl)imino]diethanol hydrochloride (CAS: 94158-13-1)?

When handling 2,2'-[(4-Amino-3-nitrophenyl)imino]diethanol hydrochloride (CAS: 94158-13-1), it is im...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...