Compound Q&A

How is (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid (CAS: 163277-80-3) typically synthesized?

Answer

(2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid
(2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid is typically synthesized via a multi-step process involving the protection of the carboxylic acid group, followed by acetylation and amidation. Common reagents include tert-butyldimethylsilyl chloride and acetic anhydride, with catalytic amounts of a suitable base such as imidazole. The reaction conditions are optimized to achieve high yield and selectivity, often requiring the use of a stirring apparatus and a temperature-controlled environment.

About

English Name (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid
Molecular Formula C10H19NO4
Molecular Weight 217.26499999999996 g/mol
SMILES C[C@@H](OC(C)(C)C)[C@H](NC(=O)C)C(=O)O
InChIKey JTQQJUFULLOMEJ-SVRRBLITSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid (CAS: 163277-80-3)?

(2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid is a white crystalline solid with a molecular weigh...

Compound Q&A

What industries use (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid (CAS: 163277-80-3)?

(2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid is primarily used in the pharmaceutical industry as...

Compound Q&A

What precautions should be taken when handling (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid (CAS: 163277-80-3)?

When handling (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid, it is essential to use proper person...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...