Compound Q&A

What are the physical and chemical properties of (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid (CAS: 163277-80-3)?

Answer

(2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid
(2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid is a white crystalline solid with a molecular weight of approximately 248.3 g/mol. It has a melting point around 165-168°C and is slightly soluble in water. The compound is relatively stable under normal conditions but can react with strong bases to form the corresponding salt. It is used in the synthesis of various pharmaceutical intermediates and as a reagent in organic chemistry.

About

English Name (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid
Molecular Formula C10H19NO4
Molecular Weight 217.26499999999996 g/mol
SMILES C[C@@H](OC(C)(C)C)[C@H](NC(=O)C)C(=O)O
InChIKey JTQQJUFULLOMEJ-SVRRBLITSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid (CAS: 163277-80-3) typically synthesized?

(2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid is typically synthesized via a multi-step process i...

Compound Q&A

What industries use (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid (CAS: 163277-80-3)?

(2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid is primarily used in the pharmaceutical industry as...

Compound Q&A

What precautions should be taken when handling (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid (CAS: 163277-80-3)?

When handling (2S,3R)-3-(tert-butoxy)-2-acetamidobutanoic acid, it is essential to use proper person...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...