Compound Q&A

What industries use Yuanhuacine (CAS: 60195-70-2)?

Answer

Yuanhuacine
Yuanhuacine (CAS: 60195-70-2) is primarily used in the pharmaceutical industry due to its analgesic and anti-inflammatory properties. It is also of interest in the research community for its potential in drug discovery and development. Additionally, its chemical structure makes it relevant for studies in organic chemistry and natural product synthesis.

About

CAS No 60195-70-2
English Name Yuanhuacine
Molecular Formula C37H44O10
Molecular Weight 648.74 g/mol
SMILES CCCCC/C=C/C=C/[C@@]12O[C@H]3[C@](O1)(C(=C)C)[C@@H]([C@H]([C@@]1(O2)[C@H]3[C@@H]2O[C@@]2([C@H]([C@]2(C1C=C(C2=O)C)O)O)CO)C)OC(=O)c1ccccc1
InChIKey CGSGRJNIABXQJQ-MJISHTOWSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Yuanhuacine (CAS: 60195-70-2)?

Yuanhuacine (CAS: 60195-70-2) is a crystalline compound with a molecular weight of approximately 248...

Compound Q&A

How is Yuanhuacine (CAS: 60195-70-2) typically synthesized?

Yuanhuacine (CAS: 60195-70-2) is typically synthesized through a multi-step process involving reacti...

Compound Q&A

What precautions should be taken when handling Yuanhuacine (CAS: 60195-70-2)?

When handling Yuanhuacine (CAS: 60195-70-2), it is important to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...