Compound Q&A

What are the physical and chemical properties of 2,4-Dichlorophenyl benzenesulfonate (CAS: 97-16-5)?

Answer

2,4-Dichlorophenyl benzenesulfonate
2,4-Dichlorophenyl benzenesulfonate is a crystalline solid with a molecular weight of approximately 269.04 g/mol. It has low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but may react with strong bases. This compound is commonly used in analytical chemistry due to its reactivity and stability under certain conditions.

About

CAS No 97-16-5
English Name 2,4-Dichlorophenyl benzenesulfonate
Molecular Formula C12H8Cl2O3S
Molecular Weight 303.17 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)OC2=C(C=C(C=C2)Cl)Cl
InChIKey OZFAFGSSMRRTDW-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is 2,4-Dichlorophenyl benzenesulfonate (CAS: 97-16-5) typically synthesized?

2,4-Dichlorophenyl benzenesulfonate is typically synthesized through the sulfonation of 2,4-dichloro...

Compound Q&A

What industries use 2,4-Dichlorophenyl benzenesulfonate (CAS: 97-16-5)?

2,4-Dichlorophenyl benzenesulfonate is primarily used in the pharmaceutical industry as an intermedi...

Compound Q&A

What precautions should be taken when handling 2,4-Dichlorophenyl benzenesulfonate (CAS: 97-16-5)?

Proper personal protective equipment (PPE) should be worn when handling 2,4-dichlorophenyl benzenesu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...