Compound Q&A

What industries use 7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside (CAS: 20186-29-2)?

Answer

7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside
7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside is used in the pharmaceutical industry for the synthesis of complex organic molecules. It is also utilized in the food industry as a functional ingredient, and in the cosmetic industry for its potential skin benefits. Additionally, it has applications in sensor technology and as a building block in polymer synthesis.

About

CAS No 20186-29-2
English Name 7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside
Molecular Formula C16H18O9
Molecular Weight 354.31 g/mol
SMILES O=C1C=CC2=C(O1)C=C(OC)C(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)=C2
InChIKey WBAVLTNIRYDCPM-YMILTQATSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside (CAS: 20186-29-2)?

7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside is a crystalline solid with a molecular weigh...

Compound Q&A

How is 7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside (CAS: 20186-29-2) typically synthesized?

7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside is typically synthesized through a multi-step...

Compound Q&A

What precautions should be taken when handling 7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside (CAS: 20186-29-2)?

When handling 7-Methoxy-2-oxo-2H-chromen-6-yl beta-D-glucopyranoside, ensure the use of personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...