Compound Q&A

How is 4-Bromo-3,5-dimethylbenzoic acid (CAS: 7697-32-7) typically synthesized?

Answer

4-Bromo-3,5-dimethylbenzoic acid
4-Bromo-3,5-dimethylbenzoic acid is typically synthesized by the bromination of 3,5-dimethylbenzoic acid followed by an acylation step. This process involves the use of bromine and a suitable base, such as sodium hydride, in an organic solvent. The reaction is carried out under controlled conditions to ensure high selectivity and yield.

About

CAS No 7697-32-7
English Name 4-Bromo-3,5-dimethylbenzoic acid
Molecular Formula C9H9BrO2
Molecular Weight 229.07 g/mol
SMILES CC1=CC(=CC(=C1Br)C)C(=O)O
InChIKey OKEOADKQDIJJMU-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-3,5-dimethylbenzoic acid (CAS: 7697-32-7)?

4-Bromo-3,5-dimethylbenzoic acid (CAS: 7697-32-7) is a crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 4-Bromo-3,5-dimethylbenzoic acid (CAS: 7697-32-7)?

4-Bromo-3,5-dimethylbenzoic acid (CAS: 7697-32-7) is primarily used in pharmaceuticals, where it ser...

Compound Q&A

What precautions should be taken when handling 4-Bromo-3,5-dimethylbenzoic acid (CAS: 7697-32-7)?

When handling 4-Bromo-3,5-dimethylbenzoic acid (CAS: 7697-32-7), it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...