Compound Q&A

What industries use L-2,6-Difluorophenylalanine (CAS: 33787-05-2)?

Answer

L-2,6-Difluorophenylalanine
L-2,6-Difluorophenylalanine finds applications in the pharmaceutical industry for the synthesis of chiral pharmaceuticals. It is also used in polymer chemistry for the development of certain biodegradable polymers. Additionally, it has potential in the sensor and semiconductor industries for specific applications requiring chiral molecules.

About

CAS No 33787-05-2
English Name L-2,6-Difluorophenylalanine
Molecular Formula C9H9F2NO2
Molecular Weight 201.17 g/mol
SMILES C1=CC(=C(C(=C1)F)CC(C(=O)O)N)F
InChIKey RFOVYDPRGDZBLJ-QMMMGPOBSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of L-2,6-Difluorophenylalanine (CAS: 33787-05-2)?

L-2,6-Difluorophenylalanine is a crystalline solid with a molecular weight of approximately 218.09 g...

Compound Q&A

How is L-2,6-Difluorophenylalanine (CAS: 33787-05-2) typically synthesized?

L-2,6-Difluorophenylalanine is typically synthesized via kinetic resolution of (S)-2,6-difluoropheny...

Compound Q&A

What precautions should be taken when handling L-2,6-Difluorophenylalanine (CAS: 33787-05-2)?

When handling L-2,6-Difluorophenylalanine, use appropriate personal protective equipment (PPE) inclu...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...