Compound Q&A

How is 1-(3-Nitrophenyl)piperazine (CAS: 54054-85-2) typically synthesized?

Answer

1-(3-Nitrophenyl)piperazine
1-(3-Nitrophenyl)piperazine can be synthesized via a multistep procedure starting from piperazine and 3-nitrobenzaldehyde. The synthesis involves the formation of an intermediate Schiff base, followed by an intramolecular cyclization step. Commonly, this reaction is catalyzed by pivalic acid, leading to a high yield. The overall reaction is selective and efficient, making it a suitable method for the large-scale production of this compound.

About

CAS No 54054-85-2
English Name 1-(3-Nitrophenyl)piperazine
Molecular Formula C10H13N3O2
Molecular Weight 207.23 g/mol
SMILES C1CN(CCN1)C2=CC(=CC=C2)[N+](=O)[O-]
InChIKey LHHZRIYUOZPKSG-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Nitrophenyl)piperazine (CAS: 54054-85-2)?

1-(3-Nitrophenyl)piperazine is a white crystalline solid with a molecular weight of approximately 22...

Compound Q&A

What industries use 1-(3-Nitrophenyl)piperazine (CAS: 54054-85-2)?

1-(3-Nitrophenyl)piperazine is utilized in various industries, including pharmaceuticals for its pot...

Compound Q&A

What precautions should be taken when handling 1-(3-Nitrophenyl)piperazine (CAS: 54054-85-2)?

When handling 1-(3-Nitrophenyl)piperazine, it is important to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...