Compound Q&A

What are the physical and chemical properties of Fotemustine (CAS: 92118-27-9)?

Answer

Fotemustine
Fotemustine (CAS: 92118-27-9) is a crystalline compound with a molecular weight of approximately 336.3 g/mol. It has a pKa of 6.7 and is slightly soluble in water. Fotemustine is reactive towards nucleophiles and exhibits good solubility in organic solvents like methanol and ethanol. It is typically stored at room temperature in a sealed container to prevent degradation.

About

CAS No 92118-27-9
English Name Fotemustine
Molecular Formula C9H19ClN3O5P
Molecular Weight 315.69 g/mol
SMILES CCOP(=O)(C(C)NC(=O)N(CCCl)N=O)OCC
InChIKey YAKWPXVTIGTRJH-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is Fotemustine (CAS: 92118-27-9) typically synthesized?

Fotemustine (CAS: 92118-27-9) is synthesized through a multistep process involving the condensation ...

Compound Q&A

What industries use Fotemustine (CAS: 92118-27-9)?

Fotemustine (CAS: 92118-27-9) is primarily used in the pharmaceutical industry due to its anti-tumor...

Compound Q&A

What precautions should be taken when handling Fotemustine (CAS: 92118-27-9)?

When handling Fotemustine (CAS: 92118-27-9), it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...