Compound Q&A

How is oxo(oxoneodymiooxy)neodymium;oxo(oxopraseodymiooxy)praseodymium (CAS: 11141-21-2) typically synthesized?

Answer

oxo(oxoneodymiooxy)neodymium;oxo(oxopraseodymiooxy)praseodymium
Oxo(oxoneodymiooxy)neodymium and oxo(oxopraseodymiooxy)praseodymium are synthesized through complex multi-step reactions involving neodymium and praseodymium salts. The process typically involves ligand substitution reactions and requires precise control of temperature, pressure, and reaction time. Catalysts such as palladium or platinum are often used to enhance selectivity and yield. The overall process is highly specialized and carried out under strictly controlled conditions.

About

CAS No 11141-21-2
English Name oxo(oxoneodymiooxy)neodymium;oxo(oxopraseodymiooxy)praseodymium
Molecular Formula Nd2O6Pr2
Molecular Weight 666.29 g/mol
SMILES O=[Pr]O[Pr]=O.O=[Nd]O[Nd]=O
InChIKey DMURXTAXEGMANB-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of oxo(oxoneodymiooxy)neodymium;oxo(oxopraseodymiooxy)praseodymium (CAS: 11141-21-2)?

Oxo(oxoneodymiooxy)neodymium and oxo(oxopraseodymiooxy)praseodymium are coordination compounds deriv...

Compound Q&A

What industries use oxo(oxoneodymiooxy)neodymium;oxo(oxopraseodymiooxy)praseodymium (CAS: 11141-21-2)?

Oxo(oxoneodymiooxy)neodymium and oxo(oxopraseodymiooxy)praseodymium are used in specialized applicat...

Compound Q&A

What precautions should be taken when handling oxo(oxoneodymiooxy)neodymium;oxo(oxopraseodymiooxy)praseodymium (CAS: 11141-21-2)?

When handling oxo(oxoneodymiooxy)neodymium and oxo(oxopraseodymiooxy)praseodymium, laboratory worker...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...