Compound Q&A

What industries use Ikarisoside F (CAS: 113558-14-8)?

Answer

Ikarisoside F
Ikarisoside F is primarily used in the pharmaceutical industry for its potential as a bioactive compound. It has also shown applications in the food industry for its antioxidant properties and in the sensing industry for its use in developing biosensors.

About

English Name Ikarisoside F
Molecular Formula C31H36O14
Molecular Weight 632.6 g/mol
SMILES CC1C(C(C(C(O1)OC2=C(OC3=C(C(=CC(=C3C2=O)O)O)CC=C(C)C)C4=CC=C(C=C4)O)OC5C(C(C(CO5)O)O)O)O)O
InChIKey ASPIQZXMZNLGRL-NPFMWIEOSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ikarisoside F (CAS: 113558-14-8)?

Ikarisoside F is a yellow crystalline compound with a molecular weight of approximately 522.45 g/mol...

Compound Q&A

How is Ikarisoside F (CAS: 113558-14-8) typically synthesized?

Ikarisoside F is typically synthesized through a multi-step process involving glycosylation reaction...

Compound Q&A

What precautions should be taken when handling Ikarisoside F (CAS: 113558-14-8)?

When handling Ikarisoside F, it is important to use appropriate personal protective equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...