Compound Q&A

What industries use 7-Ketodeoxycholic acid (CAS: 911-40-0)?

Answer

7-Ketodeoxycholic acid
7-Ketodeoxycholic acid is primarily used in the pharmaceutical industry for its role as a bile acid and as a precursor in the synthesis of other compounds. It is also used in research applications, particularly in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 911-40-0
English Name 7-Ketodeoxycholic acid
Molecular Formula C24H38O5
Molecular Weight 406.56 g/mol
SMILES CC(CCC(=O)O)C1CCC2C1(C(CC3C2C(=O)CC4C3(CCC(C4)O)C)O)C
InChIKey RHCPKKNRWFXMAT-RRWYKFPJSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Ketodeoxycholic acid (CAS: 911-40-0)?

7-Ketodeoxycholic acid is a crystalline compound with a molecular weight of approximately 376.35 g/m...

Compound Q&A

How is 7-Ketodeoxycholic acid (CAS: 911-40-0) typically synthesized?

7-Ketodeoxycholic acid is typically synthesized via the oxidation of deoxycholic acid. The process i...

Compound Q&A

What precautions should be taken when handling 7-Ketodeoxycholic acid (CAS: 911-40-0)?

When handling 7-Ketodeoxycholic acid, it is important to wear appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...