Compound Q&A

What industries use 4,6-Bis(difluoromethoxy)-2-pyrimidinamine (CAS: 86209-44-1)?

Answer

4,6-Bis(difluoromethoxy)-2-pyrimidinamine
4,6-Bis(difluoromethoxy)-2-pyrimidinamine (CAS: 86209-44-1) is primarily used in the pharmaceutical industry for the development of new drugs. It is also utilized in the polymer industry for the synthesis of advanced polymers and in the sensor industry for detecting specific chemical species. Additionally, its use in semiconductor manufacturing for specific applications is increasing.

About

CAS No 86209-44-1
English Name 4,6-Bis(difluoromethoxy)-2-pyrimidinamine
Molecular Formula C6H5F4N3O2
Molecular Weight 227.12 g/mol
SMILES c1c(nc(nc1OC(F)F)N)OC(F)F
InChIKey DARNJZBBTBLNCA-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,6-Bis(difluoromethoxy)-2-pyrimidinamine (CAS: 86209-44-1)?

4,6-Bis(difluoromethoxy)-2-pyrimidinamine (CAS: 86209-44-1) has a crystalline form with a molecular ...

Compound Q&A

How is 4,6-Bis(difluoromethoxy)-2-pyrimidinamine (CAS: 86209-44-1) typically synthesized?

4,6-Bis(difluoromethoxy)-2-pyrimidinamine (CAS: 86209-44-1) is typically synthesized via a multistep...

Compound Q&A

What precautions should be taken when handling 4,6-Bis(difluoromethoxy)-2-pyrimidinamine (CAS: 86209-44-1)?

When handling 4,6-Bis(difluoromethoxy)-2-pyrimidinamine (CAS: 86209-44-1), it is essential to use ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...