Compound Q&A

What industries use N,N,N-Trimethylmethanaminium tetrafluoroborate (CAS: 661-36-9)?

Answer

N,N,N-Trimethylmethanaminium tetrafluoroborate
N,N,N-Trimethylmethanaminium tetrafluoroborate (CAS: 661-36-9) is used in the pharmaceutical industry for the synthesis of certain organic compounds, in polymer industries as a catalyst or additive, and in the electronics industry for the production of semiconductors and sensors.

About

CAS No 661-36-9
English Name N,N,N-Trimethylmethanaminium tetrafluoroborate
Molecular Formula C4H12BF4N
Molecular Weight 160.95 g/mol
SMILES [B-](F)(F)(F)F.C[N+](C)(C)C
InChIKey XWFABLFRYCHILB-UHFFFAOYSA-N
Last Updated: 2025-10-31 20:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Trimethylmethanaminium tetrafluoroborate (CAS: 661-36-9)?

N,N,N-Trimethylmethanaminium tetrafluoroborate (CAS: 661-36-9) is a crystalline compound with a mole...

Compound Q&A

How is N,N,N-Trimethylmethanaminium tetrafluoroborate (CAS: 661-36-9) typically synthesized?

N,N,N-Trimethylmethanaminium tetrafluoroborate (CAS: 661-36-9) is typically synthesized by reacting ...

Compound Q&A

What precautions should be taken when handling N,N,N-Trimethylmethanaminium tetrafluoroborate (CAS: 661-36-9)?

When handling N,N,N-Trimethylmethanaminium tetrafluoroborate (CAS: 661-36-9), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...